Products 1119103-42-2
CAS 1119103-42-2 is the registry number for tert-butyl N-[(5-nitropyridin-2-yl)methyl]carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl N-[(5-nitro-2-pyridinyl)methyl]carbamate (CAS 1119103-42-2) is a chemical compound with the molecular formula C11H15N3O4 and a molecular weight of 253.25 g/mol. IUPAC name: tert-butyl N-[(5-nitro-2-pyridinyl)methyl]carbamate. InChIKey: PZFFLSWUBIVDJT-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O4 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | tert-butyl N-[(5-nitro-2-pyridinyl)methyl]carbamate |
| InChIKey | PZFFLSWUBIVDJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)