Products 2248353-71-9
CAS 2248353-71-9 is the registry number for 4-((tert-Butoxycarbonyl)amino)-2-methylpyrimidine-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrimidine-5-carboxylic acid (CAS 2248353-71-9) is a chemical compound with the molecular formula C11H15N3O4 and a molecular weight of 253.25 g/mol. IUPAC name: 2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrimidine-5-carboxylic acid. InChIKey: NYLDSSFMOUXBDI-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O4 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrimidine-5-carboxylic acid |
| InChIKey | NYLDSSFMOUXBDI-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C(=N1)NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)