CAS 1119425-87-4 appears in our catalog under these names: 5-(6-Chloropyridazin-3-yl)-2-ethyl-n-methylbenzenesulfonamide, 95%, 5-(6-Chloropyridazin-3-yl)-2-ethyl-N-methylbenzenesulfonamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-(6-chloropyridazin-3-yl)-2-ethyl-N-methylbenzenesulfonamide (CAS 1119425-87-4) is a chemical compound with the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. IUPAC name: 5-(6-chloropyridazin-3-yl)-2-ethyl-N-methylbenzenesulfonamide. InChIKey: CFTUMCPZELTRDX-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O2S |
|---|---|
| Molecular weight | 311.79 g/mol |
| IUPAC name | 5-(6-chloropyridazin-3-yl)-2-ethyl-N-methylbenzenesulfonamide |
| InChIKey | CFTUMCPZELTRDX-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)C2=NN=C(C=C2)Cl)S(=O)(=O)NC |
Computed by PubChem (NCBI)