CAS 497060-71-6 appears in our catalog under these names: 1-(4-Chlorobenzoyl)-3-(4-formylpiperazinyl)thiourea, 1-(4-Chlorobenzoyl)-3-(4-formylpiperazinyl)thiourea, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 10mg, 5mg, 25mg, 5g.
4-chloro-N-(4-formylpiperazine-1-carbothioyl)benzamide (CAS 497060-71-6) is a chemical compound with the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. IUPAC name: 4-chloro-N-(4-formylpiperazine-1-carbothioyl)benzamide. InChIKey: SHKURZAEHROCEF-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O2S |
|---|---|
| Molecular weight | 311.79 g/mol |
| IUPAC name | 4-chloro-N-(4-formylpiperazine-1-carbothioyl)benzamide |
| InChIKey | SHKURZAEHROCEF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C=O)C(=S)NC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)