CAS 1119448-99-5 is the registry number for Ethyl 3,6-dibromoimidazo[1,2-a]pyridine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3,6-dibromoimidazo[1,2-a]pyridine-2-carboxylate (CAS 1119448-99-5) is a chemical compound with the molecular formula C10H8Br2N2O2 and a molecular weight of 347.99 g/mol. IUPAC name: ethyl 3,6-dibromoimidazo[1,2-a]pyridine-2-carboxylate. InChIKey: BIFZUIRJJWFGNV-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2N2O2 |
|---|---|
| Molecular weight | 347.99 g/mol |
| IUPAC name | ethyl 3,6-dibromoimidazo[1,2-a]pyridine-2-carboxylate |
| InChIKey | BIFZUIRJJWFGNV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N2C=C(C=CC2=N1)Br)Br |
Computed by PubChem (NCBI)