Products 1202278-11-2
CAS 1202278-11-2 is the registry number for Ethyl 6,8-dibromoimidazo[1,2-a]pyridine-2-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 6,8-dibromoimidazo[1,2-a]pyridine-2-carboxylate (CAS 1202278-11-2) is a chemical compound with the molecular formula C10H8Br2N2O2 and a molecular weight of 347.99 g/mol. IUPAC name: ethyl 6,8-dibromoimidazo[1,2-a]pyridine-2-carboxylate. InChIKey: HSHAMCNJPGOVPJ-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2N2O2 |
|---|---|
| Molecular weight | 347.99 g/mol |
| IUPAC name | ethyl 6,8-dibromoimidazo[1,2-a]pyridine-2-carboxylate |
| InChIKey | HSHAMCNJPGOVPJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C=C(C=C(C2=N1)Br)Br |
Computed by PubChem (NCBI)