CAS 1119449-68-1 is the registry number for 3-(Phenoxymethyl)[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(phenoxymethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid (CAS 1119449-68-1) is a chemical compound with the molecular formula C14H11N3O3 and a molecular weight of 269.25 g/mol. IUPAC name: 3-(phenoxymethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid. InChIKey: UNYAJGRKERXSRL-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O3 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | 3-(phenoxymethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid |
| InChIKey | UNYAJGRKERXSRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=NN=C3N2C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)