CAS 1408487-81-9 is the registry number for Ethyl 3-(quinolin-6-yl)-1,2,4-oxadiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-quinolin-6-yl-1,2,4-oxadiazole-5-carboxylate (CAS 1408487-81-9) is a chemical compound with the molecular formula C14H11N3O3 and a molecular weight of 269.25 g/mol. IUPAC name: ethyl 3-quinolin-6-yl-1,2,4-oxadiazole-5-carboxylate. InChIKey: SPPYWKFVYIMHKG-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O3 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | ethyl 3-quinolin-6-yl-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | SPPYWKFVYIMHKG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NO1)C2=CC3=C(C=C2)N=CC=C3 |
Computed by PubChem (NCBI)