CAS 1119450-82-6 is the registry number for 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-n-(pyridin-2-ylmethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(pyridin-2-ylmethyl)benzamide (CAS 1119450-82-6) is a chemical compound with the molecular formula C16H13ClN4O2 and a molecular weight of 328.75 g/mol. IUPAC name: 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(pyridin-2-ylmethyl)benzamide. InChIKey: BTVMZLWTOAIYRZ-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN4O2 |
|---|---|
| Molecular weight | 328.75 g/mol |
| IUPAC name | 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(pyridin-2-ylmethyl)benzamide |
| InChIKey | BTVMZLWTOAIYRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNC(=O)C2=CC=CC(=C2)C3=NOC(=N3)CCl |
Computed by PubChem (NCBI)