Products 1185081-36-0
CAS 1185081-36-0 is the registry number for AnCDA-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-N-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]pyridine-3-carboxamide (CAS 1185081-36-0) is a chemical compound with the molecular formula C16H13ClN4O2 and a molecular weight of 328.75 g/mol. IUPAC name: 2-chloro-N-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]pyridine-3-carboxamide. InChIKey: XWMDKMZSKWPPAJ-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN4O2 |
|---|---|
| Molecular weight | 328.75 g/mol |
| IUPAC name | 2-chloro-N-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]pyridine-3-carboxamide |
| InChIKey | XWMDKMZSKWPPAJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=NO2)CNC(=O)C3=C(N=CC=C3)Cl |
Computed by PubChem (NCBI)
Synonyms:
AnCDA-IN-1, orb3028588