Products 1119477-70-1
CAS 1119477-70-1 is the registry number for 2-(5-Amino-3-cyclopropyl-1H-pyrazol-1-yl)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-amino-3-cyclopropylpyrazol-1-yl)acetic acid (CAS 1119477-70-1) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: 2-(5-amino-3-cyclopropylpyrazol-1-yl)acetic acid. InChIKey: IBMDYHOPKOCXIN-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-(5-amino-3-cyclopropylpyrazol-1-yl)acetic acid |
| InChIKey | IBMDYHOPKOCXIN-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN(C(=C2)N)CC(=O)O |
Computed by PubChem (NCBI)