CAS 111955-47-6 is the registry number for (3R,4S)-2,5-dioxotetrahydrofuran-3,4-diyl dibenzoate. Offered by: Chemat Brand. Available pack sizes: on request.
(4-benzoyloxy-2,5-dioxooxolan-3-yl) benzoate (CAS 111955-47-6) is a chemical compound with the molecular formula C18H12O7 and a molecular weight of 340.3 g/mol. IUPAC name: (4-benzoyloxy-2,5-dioxooxolan-3-yl) benzoate. InChIKey: OXIKRMSPXYQFOT-UHFFFAOYSA-N.
| Molecular formula | C18H12O7 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | (4-benzoyloxy-2,5-dioxooxolan-3-yl) benzoate |
| InChIKey | OXIKRMSPXYQFOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2C(C(=O)OC2=O)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)