CAS 112209-48-0 is the registry number for Cycloleucomelone. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-hydroxyphenyl)dibenzofuran-1,2,4,7,8-pentol (CAS 112209-48-0) is a chemical compound with the molecular formula C18H12O7 and a molecular weight of 340.3 g/mol. IUPAC name: 3-(4-hydroxyphenyl)dibenzofuran-1,2,4,7,8-pentol. InChIKey: KPLKPGSATMNRTH-UHFFFAOYSA-N.
| Molecular formula | C18H12O7 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)dibenzofuran-1,2,4,7,8-pentol |
| InChIKey | KPLKPGSATMNRTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=C3C4=CC(=C(C=C4OC3=C2O)O)O)O)O)O |
Computed by PubChem (NCBI)