CAS 111957-65-4 is the registry number for 4,5-Didehydro-5,6-dihydro-Retinol. Offered by: TRC. Available pack sizes: 25mg.
(2Z,4Z,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,4,6,8-tetraen-1-ol (CAS 111957-65-4) is a chemical compound with the molecular formula C20H30O and a molecular weight of 286.5 g/mol. IUPAC name: (2Z,4Z,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,4,6,8-tetraen-1-ol. InChIKey: DPRNENKPXAZQBI-PQCRVBQNSA-N.
| Molecular formula | C20H30O |
|---|---|
| Molecular weight | 286.5 g/mol |
| IUPAC name | (2Z,4Z,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-2-en-1-yl)nona-2,4,6,8-tetraen-1-ol |
| InChIKey | DPRNENKPXAZQBI-PQCRVBQNSA-N |
| SMILES | CC1=CCCC(C1C=C/C(=C/C=C\C(=C/CO)\C)/C)(C)C |
Computed by PubChem (NCBI)