Products 1119831-25-2
CAS 1119831-25-2 appears in our catalog under these names: S6821, S6821, 96.60%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 100mg, 10 mg, 5 mg, 1 mg.
3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-1-[(3-hydroxyphenyl)methyl]imidazolidine-2,4-dione (CAS 1119831-25-2) is a chemical compound with the molecular formula C19H19N5O4 and a molecular weight of 381.4 g/mol. IUPAC name: 3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-1-[(3-hydroxyphenyl)methyl]imidazolidine-2,4-dione. InChIKey: LLJBKECMPVCSDS-UHFFFAOYSA-N.
| Molecular formula | C19H19N5O4 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | 3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-1-[(3-hydroxyphenyl)methyl]imidazolidine-2,4-dione |
| InChIKey | LLJBKECMPVCSDS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CN2C=C(C=N2)N3C(=O)CN(C3=O)CC4=CC(=CC=C4)O |
Computed by PubChem (NCBI)