CAS 68399-16-6 appears in our catalog under these names: (2R,3S)–Pteroside C, (2R,3S)-Pteroside C. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
2-[N-(2-cyanoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl acetate (CAS 68399-16-6) is a chemical compound with the molecular formula C19H19N5O4 and a molecular weight of 381.4 g/mol. IUPAC name: 2-[N-(2-cyanoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl acetate. InChIKey: QLRDACXDRLGLOC-UHFFFAOYSA-N.
| Molecular formula | C19H19N5O4 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | 2-[N-(2-cyanoethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl acetate |
| InChIKey | QLRDACXDRLGLOC-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCN(CCC#N)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)