Products 111988-19-3
CAS 111988-19-3 appears in our catalog under these names: Octopamine-d3, Octopamine-d3, 99.52%. Offered by: Chemat Brand, TargetMol, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg.
4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)phenol (CAS 111988-19-3) is a chemical compound with the molecular formula C8H11NO2 and a molecular weight of 156.20 g/mol. IUPAC name: 4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)phenol. InChIKey: QHGUCRYDKWKLMG-VWTWQGAWSA-N.
| Molecular formula | C8H11NO2 |
|---|---|
| Molecular weight | 156.20 g/mol |
| IUPAC name | 4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)phenol |
| InChIKey | QHGUCRYDKWKLMG-VWTWQGAWSA-N |
| SMILES | [2H]C([2H])(C([2H])(C1=CC=C(C=C1)O)O)N |
Computed by PubChem (NCBI)
Synonyms:
Octopamine-d3, orb2280830