Products 1121057-53-1
CAS 1121057-53-1 is the registry number for tert-Butyl 3-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 3-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidine-1-carboxylate (CAS 1121057-53-1) is a chemical compound with the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. IUPAC name: tert-butyl 3-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidine-1-carboxylate. InChIKey: JCOXIBYCDBFXNL-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O3 |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | tert-butyl 3-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidine-1-carboxylate |
| InChIKey | JCOXIBYCDBFXNL-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)