CAS 1690493-80-1 is the registry number for tert-Butyl 3-((3-methyl-1,2,4-oxadiazol-5-yl)methyl)azetidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]azetidine-1-carboxylate (CAS 1690493-80-1) is a chemical compound with the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. IUPAC name: tert-butyl 3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]azetidine-1-carboxylate. InChIKey: LTIUJMXNSXCJSI-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O3 |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | tert-butyl 3-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]azetidine-1-carboxylate |
| InChIKey | LTIUJMXNSXCJSI-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)CC2CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)