Products 1121545-27-4
CAS 1121545-27-4 is the registry number for 3-Bromospiro[benzo[de]anthracene-7,9'-fluorene], 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 500mg, 1g.
3-bromospiro[benzo[a]phenalene-7,9'-fluorene] (CAS 1121545-27-4) is a chemical compound with the molecular formula C29H17Br and a molecular weight of 445.3 g/mol. IUPAC name: 3-bromospiro[benzo[a]phenalene-7,9'-fluorene]. InChIKey: DIGZNDNMQWSCOY-UHFFFAOYSA-N.
| Molecular formula | C29H17Br |
|---|---|
| Molecular weight | 445.3 g/mol |
| IUPAC name | 3-bromospiro[benzo[a]phenalene-7,9'-fluorene] |
| InChIKey | DIGZNDNMQWSCOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C(=C(C=C3)Br)C=CC=C4C25C6=CC=CC=C6C7=CC=CC=C57 |
Computed by PubChem (NCBI)