Products 1121599-68-5
CAS 1121599-68-5 appears in our catalog under these names: tert-Butyl 4-(3-fluoro-4-(methoxycarbonyl)phenyl)piperazine-1-carboxylate, 95%, tert-Butyl 4-(3-fluoro-4-(methoxycarbonyl)phenyl)piperazine-1-carboxylate. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl 4-(3-fluoro-4-methoxycarbonylphenyl)piperazine-1-carboxylate (CAS 1121599-68-5) is a chemical compound with the molecular formula C17H23FN2O4 and a molecular weight of 338.4 g/mol. IUPAC name: tert-butyl 4-(3-fluoro-4-methoxycarbonylphenyl)piperazine-1-carboxylate. InChIKey: NMDDJFNUMNDIJQ-UHFFFAOYSA-N.
| Molecular formula | C17H23FN2O4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | tert-butyl 4-(3-fluoro-4-methoxycarbonylphenyl)piperazine-1-carboxylate |
| InChIKey | NMDDJFNUMNDIJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=C(C=C2)C(=O)OC)F |
Computed by PubChem (NCBI)