CAS 1643153-39-2 is the registry number for 4-(4-Carboxy-3-fluoro-phenyl)-2-methyl-piperazine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-fluoro-4-[3-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid (CAS 1643153-39-2) is a chemical compound with the molecular formula C17H23FN2O4 and a molecular weight of 338.4 g/mol. IUPAC name: 2-fluoro-4-[3-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid. InChIKey: BPGOIZKYNDXJMK-UHFFFAOYSA-N.
| Molecular formula | C17H23FN2O4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 2-fluoro-4-[3-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid |
| InChIKey | BPGOIZKYNDXJMK-UHFFFAOYSA-N |
| SMILES | CC1CN(CCN1C(=O)OC(C)(C)C)C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)