Products 1121599-74-3
CAS 1121599-74-3 is the registry number for tert-Butyl 4-(2,4-dichlorophenyl)piperazine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 4-(2,4-dichlorophenyl)piperazine-1-carboxylate (CAS 1121599-74-3) is a chemical compound with the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.2 g/mol. IUPAC name: tert-butyl 4-(2,4-dichlorophenyl)piperazine-1-carboxylate. InChIKey: NXNOEWLVKNNXPH-UHFFFAOYSA-N.
| Molecular formula | C15H20Cl2N2O2 |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | tert-butyl 4-(2,4-dichlorophenyl)piperazine-1-carboxylate |
| InChIKey | NXNOEWLVKNNXPH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)