Products 1160260-97-8
CAS 1160260-97-8 is the registry number for rel-tert-Butyl (3R,4S)-3-amino-4-(3,4-dichlorophenyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4S)-3-amino-4-(3,4-dichlorophenyl)pyrrolidine-1-carboxylate (CAS 1160260-97-8) is a chemical compound with the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.2 g/mol. IUPAC name: tert-butyl (3R,4S)-3-amino-4-(3,4-dichlorophenyl)pyrrolidine-1-carboxylate. InChIKey: VJPRKALAWAMTQP-MFKMUULPSA-N.
| Molecular formula | C15H20Cl2N2O2 |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-amino-4-(3,4-dichlorophenyl)pyrrolidine-1-carboxylate |
| InChIKey | VJPRKALAWAMTQP-MFKMUULPSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)N)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)