CAS 112193-75-6 appears in our catalog under these names: 2,2'–(1,4,7,10–Tetraazacyclododecane–1,7–diyl)diacetic acid, 1,4,7,10-Tetraazacyclododecane-1,7-diacetic acid, 2,2'-(1,4,7,10-Tetraazacyclododecane-1,7-diyl)diacetic acid 98%, 1,4,7,10-Tetraazacyclododecane-1,7-diacetic acid, 98%, 98%, Gadoteridol Impurity 6. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Hubei YoungXin. Available pack sizes: 5mg, 10mg, 25mg, 100mg, 50mg, 250mg, 1g, 200mg.
2-[7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (CAS 112193-75-6) is a chemical compound with the molecular formula C12H24N4O4 and a molecular weight of 288.34 g/mol. IUPAC name: 2-[7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid. InChIKey: SPSJFVXUOKRIGT-UHFFFAOYSA-N.
| Molecular formula | C12H24N4O4 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | 2-[7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| InChIKey | SPSJFVXUOKRIGT-UHFFFAOYSA-N |
| SMILES | C1CN(CCNCCN(CCN1)CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)