Products 2098500-94-6
CAS 2098500-94-6 appears in our catalog under these names: N3-O2Oc-OH*CHA, 8-Azido-3,6-dioxaoctanoic Acid Cyclohexylamine Salt, >98.0%(HPLC)(T), Azido-PEG2-CH2COOH (CHA), 98.0%, 8-Azido-3,6-dioxaoctanoic acid cyclohexylammonium salt, 98%, Azido-PEG2-CH2COOH (CHA), 98%. Offered by: Iris Biotech, TCI, MedChemExpress, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 25g, 500mg, 100mg, 100 mg, 250mg.
2-[2-(2-azidoethoxy)ethoxy]acetic acid;cyclohexanamine (CAS 2098500-94-6) is a chemical compound with the molecular formula C12H24N4O4 and a molecular weight of 288.34 g/mol. IUPAC name: 2-[2-(2-azidoethoxy)ethoxy]acetic acid;cyclohexanamine. InChIKey: CVGMGYQHORMPPJ-UHFFFAOYSA-N.
| Molecular formula | C12H24N4O4 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | 2-[2-(2-azidoethoxy)ethoxy]acetic acid;cyclohexanamine |
| InChIKey | CVGMGYQHORMPPJ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N.C(COCCOCC(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)