Products 112251-53-3

CAS 112251-53-3 is the registry number for 4,5-Dichloro-2-fluoropyrimidine 98+%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4,5-dichloro-2-fluoropyrimidine (CAS 112251-53-3) is a chemical compound with the molecular formula C4HCl2FN2 and a molecular weight of 166.97 g/mol. IUPAC name: 4,5-dichloro-2-fluoropyrimidine. InChIKey: SBORVHPHDARURE-UHFFFAOYSA-N.

Identity
Molecular formulaC4HCl2FN2
Molecular weight166.97 g/mol
IUPAC name4,5-dichloro-2-fluoropyrimidine
InChIKeySBORVHPHDARURE-UHFFFAOYSA-N
SMILESC1=C(C(=NC(=N1)F)Cl)Cl

Computed by PubChem (NCBI)