CAS 2225881-71-8 is the registry number for 5-Fluoro-2,4-dichloropyrimidine-d1. Offered by: TRC. Available pack sizes: 100mg.
2,4-dichloro-6-deuterio-5-fluoropyrimidine (CAS 2225881-71-8) is a chemical compound with the molecular formula C4HCl2FN2 and a molecular weight of 167.97 g/mol. IUPAC name: 2,4-dichloro-6-deuterio-5-fluoropyrimidine. InChIKey: WHPFEQUEHBULBW-MICDWDOJSA-N.
| Molecular formula | C4HCl2FN2 |
|---|---|
| Molecular weight | 167.97 g/mol |
| IUPAC name | 2,4-dichloro-6-deuterio-5-fluoropyrimidine |
| InChIKey | WHPFEQUEHBULBW-MICDWDOJSA-N |
| SMILES | [2H]C1=C(C(=NC(=N1)Cl)Cl)F |
Computed by PubChem (NCBI)