CAS 1123169-36-7 appears in our catalog under these names: 6-Isopropyl-1-methyl-2-oxo-1,2-dihydro-3-pyridinecarboxylic acid, 95%, 6-Isopropyl-1-methyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1-methyl-2-oxo-6-propan-2-ylpyridine-3-carboxylic acid (CAS 1123169-36-7) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 1-methyl-2-oxo-6-propan-2-ylpyridine-3-carboxylic acid. InChIKey: JEXDNGUMCMJOBV-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 1-methyl-2-oxo-6-propan-2-ylpyridine-3-carboxylic acid |
| InChIKey | JEXDNGUMCMJOBV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C(=O)N1C)C(=O)O |
Computed by PubChem (NCBI)