CAS 112333-14-9 appears in our catalog under these names: N-Methyl-2-nitroaniline-d3, N-(Methyl-d3)-2-nitroaniline. Offered by: TRC, MedChemExpress. Available pack sizes: 500mg, 50mg, 25 mg, 500 mg, 100 mg, 50 mg.
2-nitro-N-(trideuteriomethyl)aniline (CAS 112333-14-9) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 155.17 g/mol. IUPAC name: 2-nitro-N-(trideuteriomethyl)aniline. InChIKey: KFBOUJZFFJDYTA-FIBGUPNXSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 155.17 g/mol |
| IUPAC name | 2-nitro-N-(trideuteriomethyl)aniline |
| InChIKey | KFBOUJZFFJDYTA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)