CAS 1124-18-1 appears in our catalog under these names: Toluene-alpha,alpha,alpha-d3, 99 atom % D, min 98% Chemical Purity, toluene–alpha,alpha,alpha–D3, Trideuteriomethylbenzene, TOLUENE-ALPHA,ALPHA,ALPHA-D3, 99 ATOM %&. Offered by: CDN, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 100mg, 500mg, 250mg, 1000mg, 2000mg, 5000mg, 5G.
Trideuteriomethylbenzene (CAS 1124-18-1) is a chemical compound with the molecular formula C7H8 and a molecular weight of 95.16 g/mol. IUPAC name: trideuteriomethylbenzene. InChIKey: YXFVVABEGXRONW-FIBGUPNXSA-N.
| Molecular formula | C7H8 |
|---|---|
| Molecular weight | 95.16 g/mol |
| IUPAC name | trideuteriomethylbenzene |
| InChIKey | YXFVVABEGXRONW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=CC=C1 |
Computed by PubChem (NCBI)