CAS 287399-35-3 is the registry number for Methyl(1,2,3,4,5,6-13C6)cyclohexatriene. Offered by: Biosynth. Available pack sizes: 100mg, 50mg.
Methyl(1,2,3,4,5,6-13C6)cyclohexatriene (CAS 287399-35-3) is a chemical compound with the molecular formula C7H8 and a molecular weight of 98.095 g/mol. IUPAC name: methyl(1,2,3,4,5,6-13C6)cyclohexatriene. InChIKey: YXFVVABEGXRONW-WBJZHHNVSA-N.
| Molecular formula | C7H8 |
|---|---|
| Molecular weight | 98.095 g/mol |
| IUPAC name | methyl(1,2,3,4,5,6-13C6)cyclohexatriene |
| InChIKey | YXFVVABEGXRONW-WBJZHHNVSA-N |
| SMILES | C[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 |
Computed by PubChem (NCBI)