Products 112404-27-0
CAS 112404-27-0 is the registry number for 2-(2-(4-bromophenyl)-2-oxoethyl)-5,5-dimethylcyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[2-(4-bromophenyl)-2-oxoethyl]-5,5-dimethylcyclohexane-1,3-dione (CAS 112404-27-0) is a chemical compound with the molecular formula C16H17BrO3 and a molecular weight of 337.21 g/mol. IUPAC name: 2-[2-(4-bromophenyl)-2-oxoethyl]-5,5-dimethylcyclohexane-1,3-dione. InChIKey: WVJUCGXCMJWNEW-UHFFFAOYSA-N.
| Molecular formula | C16H17BrO3 |
|---|---|
| Molecular weight | 337.21 g/mol |
| IUPAC name | 2-[2-(4-bromophenyl)-2-oxoethyl]-5,5-dimethylcyclohexane-1,3-dione |
| InChIKey | WVJUCGXCMJWNEW-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C(=O)C1)CC(=O)C2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)