Products 1198771-82-2

CAS 1198771-82-2 is the registry number for (6-Bromo-naphthalen-2-yloxy)-acetic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Tert-butyl 2-(6-bromonaphthalen-2-yl)oxyacetate (CAS 1198771-82-2) is a chemical compound with the molecular formula C16H17BrO3 and a molecular weight of 337.21 g/mol. IUPAC name: tert-butyl 2-(6-bromonaphthalen-2-yl)oxyacetate. InChIKey: VDLRQXUQKPODIL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17BrO3
Molecular weight337.21 g/mol
IUPAC nametert-butyl 2-(6-bromonaphthalen-2-yl)oxyacetate
InChIKeyVDLRQXUQKPODIL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)COC1=CC2=C(C=C1)C=C(C=C2)Br

Computed by PubChem (NCBI)