Products 1124353-23-6
CAS 1124353-23-6 is the registry number for (-)-Cadin-4,10(15)-dien-11-oic acid. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, Get quote.
(4aS,8R,8aS)-5-methylidene-8-propan-2-yl-4,4a,6,7,8,8a-hexahydro-3H-naphthalene-2-carboxylic acid (CAS 1124353-23-6) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (4aS,8R,8aS)-5-methylidene-8-propan-2-yl-4,4a,6,7,8,8a-hexahydro-3H-naphthalene-2-carboxylic acid. InChIKey: DTPZSZZVUKXNSJ-MGPQQGTHSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (4aS,8R,8aS)-5-methylidene-8-propan-2-yl-4,4a,6,7,8,8a-hexahydro-3H-naphthalene-2-carboxylic acid |
| InChIKey | DTPZSZZVUKXNSJ-MGPQQGTHSA-N |
| SMILES | CC(C)[C@H]1CCC(=C)[C@@H]2[C@@H]1C=C(CC2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(-)-Cadin-4,10(15)-dien-11-oic acid, orb1680271