Products 112494-41-4
CAS 112494-41-4 is the registry number for (3S,5S)-Octahydrocurcumin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S,5S)-1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol (CAS 112494-41-4) is a chemical compound with the molecular formula C21H28O6 and a molecular weight of 376.4 g/mol. IUPAC name: (3S,5S)-1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol. InChIKey: OELMAFBLFOKZJD-IRXDYDNUSA-N.
| Molecular formula | C21H28O6 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | (3S,5S)-1,7-bis(4-hydroxy-3-methoxyphenyl)heptane-3,5-diol |
| InChIKey | OELMAFBLFOKZJD-IRXDYDNUSA-N |
| SMILES | COC1=C(C=CC(=C1)CC[C@@H](C[C@H](CCC2=CC(=C(C=C2)O)OC)O)O)O |
Computed by PubChem (NCBI)