CAS 5581-32-8 appears in our catalog under these names: Bisphenol A Bis(2,3-dihydroxypropyl) Ether(Mixture of Diastereomers), >95% (HPLC), Bisphenol A Bis(2,3-dihydroxypropyl) Ether, >95% (HPLC), Bisphenol A-bis(2,3-dihydroxypropyl) ether, Bisphenol A–bis(2,3–dihydroxypropyl) ether, 3,3'-((Propane-2,2-diylbis(4,1-phenylene))bis(oxy))bis(propane-1,2-diol) 95%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 50mg, 500mg, 250mg.
3-[4-[2-[4-(2,3-dihydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol (CAS 5581-32-8) is a chemical compound with the molecular formula C21H28O6 and a molecular weight of 376.4 g/mol. IUPAC name: 3-[4-[2-[4-(2,3-dihydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol. InChIKey: NISVZEWKUNUGQQ-UHFFFAOYSA-N.
| Molecular formula | C21H28O6 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 3-[4-[2-[4-(2,3-dihydroxypropoxy)phenyl]propan-2-yl]phenoxy]propane-1,2-diol |
| InChIKey | NISVZEWKUNUGQQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OCC(CO)O)C2=CC=C(C=C2)OCC(CO)O |
Computed by PubChem (NCBI)