CAS 112495-91-7 is the registry number for Bacitracin Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1S,2S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-1,3-thiazole-4-carboxylic acid (CAS 112495-91-7) is a chemical compound with the molecular formula C14H22N2O4S and a molecular weight of 314.40 g/mol. IUPAC name: 2-[(1S,2S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-1,3-thiazole-4-carboxylic acid. InChIKey: RKOUCOLDVUPOSI-WPRPVWTQSA-N.
| Molecular formula | C14H22N2O4S |
|---|---|
| Molecular weight | 314.40 g/mol |
| IUPAC name | 2-[(1S,2S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | RKOUCOLDVUPOSI-WPRPVWTQSA-N |
| SMILES | CC[C@H](C)[C@@H](C1=NC(=CS1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)