Products 4493-18-9
CAS 4493-18-9 appears in our catalog under these names: Benzylpenicillin (Benzathine) tetrahydrate EP Impurity I, (2S,5R,6R)-6-Hexanamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,5R,6R)-6-(hexanoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 4493-18-9) is a chemical compound with the molecular formula C14H22N2O4S and a molecular weight of 314.40 g/mol. IUPAC name: (2S,5R,6R)-6-(hexanoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: ACAZKHULUUVWCY-JFGNBEQYSA-N.
| Molecular formula | C14H22N2O4S |
|---|---|
| Molecular weight | 314.40 g/mol |
| IUPAC name | (2S,5R,6R)-6-(hexanoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | ACAZKHULUUVWCY-JFGNBEQYSA-N |
| SMILES | CCCCCC(=O)N[C@H]1[C@@H]2N(C1=O)[C@H](C(S2)(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Penicillin DF, Dihydropenicillin F, Hexanoylpenicillin, Amylpenicillin, Penicillin F, dihydro-, AMYLPENICILLIN [MI], 4-27-00-05859 (Beilstein Handbook Reference), Benzylpenicillin (Benzathine) Tetrahydrate EP Impurity I, BENZYLPENICILLIN SODIUM IMPURITY H [EP IMPURITY], BENZATHINE BENZYLPENICILLIN IMPURITY I [EP IMPURITY]