Products 101537-66-0
CAS 101537-66-0 is the registry number for N2,N3-Di-Boc-thiophene-2,3-diamine, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophen-3-yl]carbamate (CAS 101537-66-0) is a chemical compound with the molecular formula C14H22N2O4S and a molecular weight of 314.40 g/mol. IUPAC name: tert-butyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophen-3-yl]carbamate. InChIKey: DHIUHHQCRHSQSQ-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O4S |
|---|---|
| Molecular weight | 314.40 g/mol |
| IUPAC name | tert-butyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophen-3-yl]carbamate |
| InChIKey | DHIUHHQCRHSQSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(SC=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)