Products 112565-67-0
CAS 112565-67-0 is the registry number for 3,3-Dimethyl-1-tosyl-2,3-dihydroquinolin-4(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-dimethyl-1-(4-methylphenyl)sulfonyl-2H-quinolin-4-one (CAS 112565-67-0) is a chemical compound with the molecular formula C18H19NO3S and a molecular weight of 329.4 g/mol. IUPAC name: 3,3-dimethyl-1-(4-methylphenyl)sulfonyl-2H-quinolin-4-one. InChIKey: IDGGMIHGIQIGMM-UHFFFAOYSA-N.
| Molecular formula | C18H19NO3S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 3,3-dimethyl-1-(4-methylphenyl)sulfonyl-2H-quinolin-4-one |
| InChIKey | IDGGMIHGIQIGMM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC(C(=O)C3=CC=CC=C32)(C)C |
Computed by PubChem (NCBI)