CAS 1423037-53-9 is the registry number for 1-BOC-3-[hydroxy(thiophen-2-yl)methyl]indole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl 3-[hydroxy(thiophen-2-yl)methyl]indole-1-carboxylate (CAS 1423037-53-9) is a chemical compound with the molecular formula C18H19NO3S and a molecular weight of 329.4 g/mol. IUPAC name: tert-butyl 3-[hydroxy(thiophen-2-yl)methyl]indole-1-carboxylate. InChIKey: TURJSXLXTAJRCP-UHFFFAOYSA-N.
| Molecular formula | C18H19NO3S |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | tert-butyl 3-[hydroxy(thiophen-2-yl)methyl]indole-1-carboxylate |
| InChIKey | TURJSXLXTAJRCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C(C3=CC=CS3)O |
Computed by PubChem (NCBI)