CAS 1126-58-5 appears in our catalog under these names: Girard's Reagent P, >95% (HPLC), Girard’s Reagent P, >95% (HPLC), Girard's Reagent P, Girard's reagent P, Girard's Reagent P, >95.0%(T). Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 10g, 25g, 5g, 50g, 250g, 100g, 1g, 50 mg.
2-pyridin-1-ium-1-ylacetohydrazide chloride (CAS 1126-58-5) is a chemical compound with the molecular formula C7H10ClN3O and a molecular weight of 187.63 g/mol. IUPAC name: 2-pyridin-1-ium-1-ylacetohydrazide chloride. InChIKey: NDXLVXDHVHWYFR-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3O |
|---|---|
| Molecular weight | 187.63 g/mol |
| IUPAC name | 2-pyridin-1-ium-1-ylacetohydrazide chloride |
| InChIKey | NDXLVXDHVHWYFR-UHFFFAOYSA-N |
| SMILES | C1=CC=[N+](C=C1)CC(=O)NN.[Cl-] |
Computed by PubChem (NCBI)