Products 1505505-87-2
CAS 1505505-87-2 appears in our catalog under these names: Girard’s Reagent P-d5, >95% (HPLC), Girard's Reagent P–d5, Girard's Reagent P-d5, 99.9%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 1g, 10mg, 25mg, 5mg, 50mg, 50 mg, 5 mg, 25 mg.
2-(2,3,4,5,6-pentadeuteriopyridin-1-ium-1-yl)acetohydrazide chloride (CAS 1505505-87-2) is a chemical compound with the molecular formula C7H10ClN3O and a molecular weight of 192.66 g/mol. IUPAC name: 2-(2,3,4,5,6-pentadeuteriopyridin-1-ium-1-yl)acetohydrazide chloride. InChIKey: NDXLVXDHVHWYFR-GWVWGMRQSA-N.
| Molecular formula | C7H10ClN3O |
|---|---|
| Molecular weight | 192.66 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentadeuteriopyridin-1-ium-1-yl)acetohydrazide chloride |
| InChIKey | NDXLVXDHVHWYFR-GWVWGMRQSA-N |
| SMILES | [2H]C1=C(C(=[N+](C(=C1[2H])[2H])CC(=O)NN)[2H])[2H].[Cl-] |
Computed by PubChem (NCBI)