Products 1126138-12-2
CAS 1126138-12-2 is the registry number for 2,4,6-Trimethyl-5-nitrobenzene-d11. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1,3-dideuterio-5-nitro-2,4,6-tris(trideuteriomethyl)benzene (CAS 1126138-12-2) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 176.26 g/mol. IUPAC name: 1,3-dideuterio-5-nitro-2,4,6-tris(trideuteriomethyl)benzene. InChIKey: SCEKDQTVGHRSNS-JXCHDVSKSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | 1,3-dideuterio-5-nitro-2,4,6-tris(trideuteriomethyl)benzene |
| InChIKey | SCEKDQTVGHRSNS-JXCHDVSKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[N+](=O)[O-])C([2H])([2H])[2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)