Products 1126365-74-9
CAS 1126365-74-9 is the registry number for Hedgehog IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-methyl-5-(5-methyl-1H-imidazol-2-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide (CAS 1126365-74-9) is a chemical compound with the molecular formula C24H22N4O2 and a molecular weight of 398.5 g/mol. IUPAC name: N-[2-methyl-5-(5-methyl-1H-imidazol-2-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide. InChIKey: GMVNSGUKXHWVSS-UHFFFAOYSA-N.
| Molecular formula | C24H22N4O2 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | N-[2-methyl-5-(5-methyl-1H-imidazol-2-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide |
| InChIKey | GMVNSGUKXHWVSS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NC=C(N2)C)NC(=O)C3=CC=C(C=C3)OCC4=CC=CC=N4 |
Computed by PubChem (NCBI)
Synonyms:
Hedgehog IN-2, orb2278216