CAS 112641-23-3 is the registry number for N-(4-Chloro-2-methyl-3-(trifluoromethyl)phenyl)-2,2-dimethylpropanamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-[4-chloro-2-methyl-3-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide (CAS 112641-23-3) is a chemical compound with the molecular formula C13H15ClF3NO and a molecular weight of 293.71 g/mol. IUPAC name: N-[4-chloro-2-methyl-3-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide. InChIKey: DOTFDVJUHLEXJF-UHFFFAOYSA-N.
| Molecular formula | C13H15ClF3NO |
|---|---|
| Molecular weight | 293.71 g/mol |
| IUPAC name | N-[4-chloro-2-methyl-3-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide |
| InChIKey | DOTFDVJUHLEXJF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(F)(F)F)Cl)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)