CAS 64670-97-9 is the registry number for 4-(3-Trifluoromethylbenzoyl)piperidine Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
Piperidin-4-yl-[3-(trifluoromethyl)phenyl]methanone;hydrochloride (CAS 64670-97-9) is a chemical compound with the molecular formula C13H15ClF3NO and a molecular weight of 293.71 g/mol. IUPAC name: piperidin-4-yl-[3-(trifluoromethyl)phenyl]methanone;hydrochloride. InChIKey: PDVVRWPFYGBBSK-UHFFFAOYSA-N.
| Molecular formula | C13H15ClF3NO |
|---|---|
| Molecular weight | 293.71 g/mol |
| IUPAC name | piperidin-4-yl-[3-(trifluoromethyl)phenyl]methanone;hydrochloride |
| InChIKey | PDVVRWPFYGBBSK-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)