Products 112667-74-0
CAS 112667-74-0 is the registry number for 4-Methyl-N'-(4-(methylamino)benzylidene)benzenesulfonohydrazide, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-N-[(E)-[4-(methylamino)phenyl]methylideneamino]benzenesulfonamide (CAS 112667-74-0) is a chemical compound with the molecular formula C15H17N3O2S and a molecular weight of 303.4 g/mol. IUPAC name: 4-methyl-N-[(E)-[4-(methylamino)phenyl]methylideneamino]benzenesulfonamide. InChIKey: NKEXVWKGKUCNRH-GZTJUZNOSA-N.
| Molecular formula | C15H17N3O2S |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 4-methyl-N-[(E)-[4-(methylamino)phenyl]methylideneamino]benzenesulfonamide |
| InChIKey | NKEXVWKGKUCNRH-GZTJUZNOSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC=C(C=C2)NC |
Computed by PubChem (NCBI)