Products 112668-54-9
CAS 112668-54-9 appears in our catalog under these names: 16–Azidohexadecanoic acid, 16-Azido-palmitic acid, Azidopalmitic acid, 16-Azidohexadecanoic acid, 98.0%, 16-Azidohexadecanoic acid, 98%. Offered by: GLPBio, Iris Biotech, Biosynth, MedChemExpress, Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 500mg, 1g, 5mg, 2mg.
16-azidohexadecanoic acid (CAS 112668-54-9) is a chemical compound with the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. IUPAC name: 16-azidohexadecanoic acid. InChIKey: VLFHDUVVGCRNIZ-UHFFFAOYSA-N.
| Molecular formula | C16H31N3O2 |
|---|---|
| Molecular weight | 297.44 g/mol |
| IUPAC name | 16-azidohexadecanoic acid |
| InChIKey | VLFHDUVVGCRNIZ-UHFFFAOYSA-N |
| SMILES | C(CCCCCCCC(=O)O)CCCCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)